C18H27N3O2 — CID 144513424
N-tert-butyl-3-[2-(methylamino)-1,3-oxazol-5-yl]benzamide;propane (PubChem CID 144513424) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-tert-butyl-3-[2-(methylamino)-1,3-oxazol-5-yl]benzamide;propane.
| Compound Name | N-tert-butyl-3-[2-(methylamino)-1,3-oxazol-5-yl]benzamide;propane |
|---|---|
| PubChem CID | 144513424 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-tert-butyl-3-[2-(methylamino)-1,3-oxazol-5-yl]benzamide;propane |
| SMILES | CCC.CNc1ncc(-c2cccc(C(=O)NC(C)(C)C)c2)o1 |
| InChI | InChI=1S/C15H19N3O2.C3H8/c1-15(2,3)18-13(19)11-7-5-6-10(8-11)12-9-17-14(16-4)20-12;1-3-2/h5-9H,1-4H3,(H,16,17)(H,18,19);3H2,1-2H3 |
| InChIKey | LAXUQHJLYYUEJA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |