C28H30O2 — CID 144513635
3-[2-(4-methylcyclopenta-1,3-dien-1-yl)-2-oxoethyl]-4-[4-(2-methylphenyl)cyclohexyl]benzaldehyde (PubChem CID 144513635) has the molecular formula C28H30O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 3-[2-(4-methylcyclopenta-1,3-dien-1-yl)-2-oxoethyl]-4-[4-(2-methylphenyl)cyclohexyl]benzaldehyde.
| Compound Name | 3-[2-(4-methylcyclopenta-1,3-dien-1-yl)-2-oxoethyl]-4-[4-(2-methylphenyl)cyclohexyl]benzaldehyde |
|---|---|
| PubChem CID | 144513635 |
| Molecular Formula | C28H30O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3-[2-(4-methylcyclopenta-1,3-dien-1-yl)-2-oxoethyl]-4-[4-(2-methylphenyl)cyclohexyl]benzaldehyde |
| SMILES | CC1=CC=C(C(=O)Cc2cc(C=O)ccc2C2CCC(c3ccccc3C)CC2)C1 |
| InChI | InChI=1S/C28H30O2/c1-19-7-9-24(15-19)28(30)17-25-16-21(18-29)8-14-27(25)23-12-10-22(11-13-23)26-6-4-3-5-20(26)2/h3-9,14,16,18,22-23H,10-13,15,17H2,1-2H3 |
| InChIKey | HUXYBICGLQUZSW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|