About 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane
7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane (PubChem CID 144515698) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane.
Molecular Properties
| Compound Name | 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane |
| PubChem CID | 144515698 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane |
| SMILES | CC1CCC2(CC1)CN(C(N)=O)C2.CCC(C)CC |
| InChI | InChI=1S/C10H18N2O.C6H14/c1-8-2-4-10(5-3-8)6-12(7-10)9(11)13;1-4-6(3)5-2/h8H,2-7H2,1H3,(H2,11,13);6H,4-5H2,1-3H3 |
| InChIKey | ZXGNPCYANBQROX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane?
The IUPAC name of 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane (CID 144515698) is 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane.
What is the SMILES notation for 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane?
The canonical SMILES for 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane is CC1CCC2(CC1)CN(C(N)=O)C2.CCC(C)CC.
What is the InChIKey of 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane?
The InChIKey is ZXGNPCYANBQROX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O.C6H14/c1-8-2-4-10(5-3-8)6-12(7-10)9(11)13;1-4-6(3)5-2/h8H,2-7H2,1H3,(H2,11,13);6H,4-5H2,1-3H3.
What are the key properties of 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane?
7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane has a molecular weight of 268.44 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane is sourced from PubChem (CID 144515698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).