C16H32N2O — CID 144515698
7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane (PubChem CID 144515698) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane.
| Compound Name | 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane |
|---|---|
| PubChem CID | 144515698 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 7-methyl-2-azaspiro[3.5]nonane-2-carboxamide;3-methylpentane |
| SMILES | CC1CCC2(CC1)CN(C(N)=O)C2.CCC(C)CC |
| InChI | InChI=1S/C10H18N2O.C6H14/c1-8-2-4-10(5-3-8)6-12(7-10)9(11)13;1-4-6(3)5-2/h8H,2-7H2,1H3,(H2,11,13);6H,4-5H2,1-3H3 |
| InChIKey | ZXGNPCYANBQROX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |