C19H44 — CID 144517503
1-butan-2-yl-2,3-dimethylcyclopentane;ethane;ethene (PubChem CID 144517503) has the molecular formula C19H44 and a molecular weight of 272.56 g/mol. Its IUPAC name is 1-butan-2-yl-2,3-dimethylcyclopentane;ethane;ethene.
| Compound Name | 1-butan-2-yl-2,3-dimethylcyclopentane;ethane;ethene |
|---|---|
| PubChem CID | 144517503 |
| Molecular Formula | C19H44 |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 272.34 |
| IUPAC Name | 1-butan-2-yl-2,3-dimethylcyclopentane;ethane;ethene |
| SMILES | C=C.CC.CC.CC.CCC(C)C1CCC(C)C1C |
| InChI | InChI=1S/C11H22.3C2H6.C2H4/c1-5-8(2)11-7-6-9(3)10(11)4;4*1-2/h8-11H,5-7H2,1-4H3;3*1-2H3;1-2H2 |
| InChIKey | QABUXNUJJLHHAJ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|