C17H32O2 — CID 134345909
4-butan-2-yl-1,6-dimethyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-7,9-diol (PubChem CID 134345909) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 4-butan-2-yl-1,6-dimethyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-7,9-diol.
| Compound Name | 4-butan-2-yl-1,6-dimethyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-7,9-diol |
|---|---|
| PubChem CID | 134345909 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 4-butan-2-yl-1,6-dimethyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene-7,9-diol |
| SMILES | CCC(C)C1CCC(C)C2C(O)CC(O)C(C)CC12 |
| InChI | InChI=1S/C17H32O2/c1-5-10(2)13-7-6-11(3)17-14(13)8-12(4)15(18)9-16(17)19/h10-19H,5-9H2,1-4H3 |
| InChIKey | FYGXBGSQXLFMCS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |