C10H16O2 — CID 144518500
2-(5,6-dimethyl-4-methylideneoxan-2-yl)acetaldehyde (PubChem CID 144518500) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(5,6-dimethyl-4-methylideneoxan-2-yl)acetaldehyde.
| Compound Name | 2-(5,6-dimethyl-4-methylideneoxan-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 144518500 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-(5,6-dimethyl-4-methylideneoxan-2-yl)acetaldehyde |
| SMILES | C=C1CC(CC=O)OC(C)C1C |
| InChI | InChI=1S/C10H16O2/c1-7-6-10(4-5-11)12-9(3)8(7)2/h5,8-10H,1,4,6H2,2-3H3 |
| InChIKey | KDYZVDCGAXUPIX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|