C13H12F2N6 — CID 144518924
4-(3,4-difluorophenyl)-6-(2H-tetrazol-5-yl)pyrimidine;ethane (PubChem CID 144518924) has the molecular formula C13H12F2N6 and a molecular weight of 290.28 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-6-(2H-tetrazol-5-yl)pyrimidine;ethane.
| Compound Name | 4-(3,4-difluorophenyl)-6-(2H-tetrazol-5-yl)pyrimidine;ethane |
|---|---|
| PubChem CID | 144518924 |
| Molecular Formula | C13H12F2N6 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-(3,4-difluorophenyl)-6-(2H-tetrazol-5-yl)pyrimidine;ethane |
| SMILES | CC.Fc1ccc(-c2cc(-c3nn[nH]n3)ncn2)cc1F |
| InChI | InChI=1S/C11H6F2N6.C2H6/c12-7-2-1-6(3-8(7)13)9-4-10(15-5-14-9)11-16-18-19-17-11;1-2/h1-5H,(H,16,17,18,19);1-2H3 |
| InChIKey | JNRAZSCZANHGTB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |