C12H10F2N2 — CID 57247663
4-(3,4-difluorophenyl)-6-ethylpyrimidine (PubChem CID 57247663) has the molecular formula C12H10F2N2 and a molecular weight of 220.22 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-6-ethylpyrimidine.
| Compound Name | 4-(3,4-difluorophenyl)-6-ethylpyrimidine |
|---|---|
| PubChem CID | 57247663 |
| Molecular Formula | C12H10F2N2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-(3,4-difluorophenyl)-6-ethylpyrimidine |
| SMILES | CCc1cc(-c2ccc(F)c(F)c2)ncn1 |
| InChI | InChI=1S/C12H10F2N2/c1-2-9-6-12(16-7-15-9)8-3-4-10(13)11(14)5-8/h3-7H,2H2,1H3 |
| InChIKey | NSUWWBRAJSXKBA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |