C14H16S — CID 144519168
1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene (PubChem CID 144519168) has the molecular formula C14H16S and a molecular weight of 216.35 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene.
| Compound Name | 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene |
|---|---|
| PubChem CID | 144519168 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene |
| SMILES | CCc1ccccc1SC1=CC=CCC1 |
| InChI | InChI=1S/C14H16S/c1-2-12-8-6-7-11-14(12)15-13-9-4-3-5-10-13/h3-4,6-9,11H,2,5,10H2,1H3 |
| InChIKey | ORTKDGMWGOOVEQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |