About 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene
1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene (PubChem CID 144519168) has the molecular formula C14H16S
and a molecular weight of 216.35 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene |
| PubChem CID | 144519168 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene |
| SMILES | CCc1ccccc1SC1=CC=CCC1 |
| InChI | InChI=1S/C14H16S/c1-2-12-8-6-7-11-14(12)15-13-9-4-3-5-10-13/h3-4,6-9,11H,2,5,10H2,1H3 |
| InChIKey | ORTKDGMWGOOVEQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene?
The IUPAC name of 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene (CID 144519168) is 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene is CCc1ccccc1SC1=CC=CCC1.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene?
The InChIKey is ORTKDGMWGOOVEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16S/c1-2-12-8-6-7-11-14(12)15-13-9-4-3-5-10-13/h3-4,6-9,11H,2,5,10H2,1H3.
What are the key properties of 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene?
1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene has a molecular weight of 216.35 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-ylsulfanyl-2-ethylbenzene is sourced from PubChem (CID 144519168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).