C26H23F3N6O3 — CID 144521680
3-amino-2-[N-(4-cyanophenyl)-C-[4-methyl-2,6-dioxo-1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]carbonimidoyl]prop-2-enamide (PubChem CID 144521680) has the molecular formula C26H23F3N6O3 and a molecular weight of 524.50 g/mol. Its IUPAC name is 3-amino-2-[N-(4-cyanophenyl)-C-[4-methyl-2,6-dioxo-1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]carbonimidoyl]prop-2-enamide.
| Compound Name | 3-amino-2-[N-(4-cyanophenyl)-C-[4-methyl-2,6-dioxo-1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]carbonimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 144521680 |
| Molecular Formula | C26H23F3N6O3 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 3-amino-2-[N-(4-cyanophenyl)-C-[4-methyl-2,6-dioxo-1-propan-2-yl-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]carbonimidoyl]prop-2-enamide |
| SMILES | Cc1c(/C(=N/c2ccc(C#N)cc2)C(=CN)C(N)=O)c(=O)n(C(C)C)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H23F3N6O3/c1-14(2)34-24(37)21(15(3)35(25(34)38)19-6-4-5-17(11-19)26(27,28)29)22(20(13-31)23(32)36)33-18-9-7-16(12-30)8-10-18/h4-11,13-14H,31H2,1-3H3,(H2,32,36)/b20-13?,33-22+ |
| InChIKey | FNZYJZKKPJZNQD-OXIPWQFYSA-N |
| XLogP | 3.23 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|