C24H18F3N5O2 — CID 90197137
4-[(2Z)-2-[3-[1-ethyl-4-methyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]prop-2-ynylidene]hydrazinyl]benzonitrile (PubChem CID 90197137) has the molecular formula C24H18F3N5O2 and a molecular weight of 465.44 g/mol. Its IUPAC name is 4-[(2Z)-2-[3-[1-ethyl-4-methyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]prop-2-ynylidene]hydrazinyl]benzonitrile.
| Compound Name | 4-[(2Z)-2-[3-[1-ethyl-4-methyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]prop-2-ynylidene]hydrazinyl]benzonitrile |
|---|---|
| PubChem CID | 90197137 |
| Molecular Formula | C24H18F3N5O2 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 4-[(2Z)-2-[3-[1-ethyl-4-methyl-2,6-dioxo-3-[3-(trifluoromethyl)phenyl]pyrimidin-5-yl]prop-2-ynylidene]hydrazinyl]benzonitrile |
| SMILES | CCn1c(=O)c(C#C/C=N\Nc2ccc(C#N)cc2)c(C)n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C24H18F3N5O2/c1-3-31-22(33)21(8-5-13-29-30-19-11-9-17(15-28)10-12-19)16(2)32(23(31)34)20-7-4-6-18(14-20)24(25,26)27/h4,6-7,9-14,30H,3H2,1-2H3/b29-13- |
| InChIKey | PMMIZWAWTXPUHZ-DBFSUHOCSA-N |
| XLogP | 3.67 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|