C14H12F3N3O4 — CID 90251667
3-ethyl-6-methyl-5-nitro-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione (PubChem CID 90251667) has the molecular formula C14H12F3N3O4 and a molecular weight of 343.26 g/mol. Its IUPAC name is 3-ethyl-6-methyl-5-nitro-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione.
| Compound Name | 3-ethyl-6-methyl-5-nitro-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90251667 |
| Molecular Formula | C14H12F3N3O4 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 3-ethyl-6-methyl-5-nitro-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c([N+](=O)[O-])c(C)n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C14H12F3N3O4/c1-3-18-12(21)11(20(23)24)8(2)19(13(18)22)10-6-4-5-9(7-10)14(15,16)17/h4-7H,3H2,1-2H3 |
| InChIKey | PCZUBQCWPIZIQF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|