C24H16F3N5O3 — CID 91588993
methyl 6-[3-[(4-cyanophenyl)diazenyl]prop-1-ynyl]-5-methyl-3-oxo-4-[3-(trifluoromethyl)phenyl]pyrazine-2-carboxylate (PubChem CID 91588993) has the molecular formula C24H16F3N5O3 and a molecular weight of 479.42 g/mol. Its IUPAC name is methyl 6-[3-[(4-cyanophenyl)diazenyl]prop-1-ynyl]-5-methyl-3-oxo-4-[3-(trifluoromethyl)phenyl]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[3-[(4-cyanophenyl)diazenyl]prop-1-ynyl]-5-methyl-3-oxo-4-[3-(trifluoromethyl)phenyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 91588993 |
| Molecular Formula | C24H16F3N5O3 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | methyl 6-[3-[(4-cyanophenyl)diazenyl]prop-1-ynyl]-5-methyl-3-oxo-4-[3-(trifluoromethyl)phenyl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(C#CC/N=N/c2ccc(C#N)cc2)c(C)n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C24H16F3N5O3/c1-15-20(7-4-12-29-31-18-10-8-16(14-28)9-11-18)30-21(23(34)35-2)22(33)32(15)19-6-3-5-17(13-19)24(25,26)27/h3,5-6,8-11,13H,12H2,1-2H3/b31-29+ |
| InChIKey | CZKSQWVLAYXCSQ-OWWNRXNESA-N |
| XLogP | 4.35 |
| TPSA | 109.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|