C20H36 — CID 144521814
3,5-bis(2,2-dimethylpropyl)tricyclo[5.2.1.02,6]decane (PubChem CID 144521814) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 3,5-bis(2,2-dimethylpropyl)tricyclo[5.2.1.02,6]decane.
| Compound Name | 3,5-bis(2,2-dimethylpropyl)tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 144521814 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 3,5-bis(2,2-dimethylpropyl)tricyclo[5.2.1.02,6]decane |
| SMILES | CC(C)(C)CC1CC(CC(C)(C)C)C2C3CCC(C3)C12 |
| InChI | InChI=1S/C20H36/c1-19(2,3)11-15-10-16(12-20(4,5)6)18-14-8-7-13(9-14)17(15)18/h13-18H,7-12H2,1-6H3 |
| InChIKey | AJHNFHXFOFSLGP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |