C11H22Si — CID 101334913
3-(2,2-dimethylpropyl)-2-silabicyclo[2.2.1]heptane (PubChem CID 101334913) has the molecular formula C11H22Si and a molecular weight of 182.38 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-2-silabicyclo[2.2.1]heptane.
| Compound Name | 3-(2,2-dimethylpropyl)-2-silabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 101334913 |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.38 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-2-silabicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)CC1[SiH2]C2CCC1C2 |
| InChI | InChI=1S/C11H22Si/c1-11(2,3)7-10-8-4-5-9(6-8)12-10/h8-10H,4-7,12H2,1-3H3 |
| InChIKey | WBODCGKGWCYNNG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|