C17H25Cl — CID 144523757
(3E,10R,12Z)-3-chloro-8,10-dimethyl-11-methylidenetetradeca-1,3,6,12-tetraene (PubChem CID 144523757) has the molecular formula C17H25Cl and a molecular weight of 264.84 g/mol. Its IUPAC name is (3E,10R,12Z)-3-chloro-8,10-dimethyl-11-methylidenetetradeca-1,3,6,12-tetraene.
| Compound Name | (3E,10R,12Z)-3-chloro-8,10-dimethyl-11-methylidenetetradeca-1,3,6,12-tetraene |
|---|---|
| PubChem CID | 144523757 |
| Molecular Formula | C17H25Cl |
| Molecular Weight | 264.84 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (3E,10R,12Z)-3-chloro-8,10-dimethyl-11-methylidenetetradeca-1,3,6,12-tetraene |
| SMILES | C=C/C(Cl)=C\CC=CC(C)C[C@@H](C)C(=C)/C=C\C |
| InChI | InChI=1S/C17H25Cl/c1-6-10-15(4)16(5)13-14(3)11-8-9-12-17(18)7-2/h6-8,10-12,14,16H,2,4,9,13H2,1,3,5H3/b10-6-,11-8?,17-12+/t14?,16-/m1/s1 |
| InChIKey | UDRSIJWLOFVZJB-UDIISGQTSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.84 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|