C13H12N2O4 — CID 144524379
1-[(2-hydroxy-3-methyl-2H-1,3-benzoxazol-5-yl)methyl]pyrrole-2,5-dione (PubChem CID 144524379) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1-[(2-hydroxy-3-methyl-2H-1,3-benzoxazol-5-yl)methyl]pyrrole-2,5-dione.
| Compound Name | 1-[(2-hydroxy-3-methyl-2H-1,3-benzoxazol-5-yl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 144524379 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-[(2-hydroxy-3-methyl-2H-1,3-benzoxazol-5-yl)methyl]pyrrole-2,5-dione |
| SMILES | CN1c2cc(CN3C(=O)C=CC3=O)ccc2OC1O |
| InChI | InChI=1S/C13H12N2O4/c1-14-9-6-8(2-3-10(9)19-13(14)18)7-15-11(16)4-5-12(15)17/h2-6,13,18H,7H2,1H3 |
| InChIKey | XNJJYJHBCMOGTC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|