C9H8FNO3 — CID 171429000
6-fluoro-2-hydroxy-1-methyl-2H-3,1-benzoxazin-4-one (PubChem CID 171429000) has the molecular formula C9H8FNO3 and a molecular weight of 197.16 g/mol. Its IUPAC name is 6-fluoro-2-hydroxy-1-methyl-2H-3,1-benzoxazin-4-one.
| Compound Name | 6-fluoro-2-hydroxy-1-methyl-2H-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 171429000 |
| Molecular Formula | C9H8FNO3 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 6-fluoro-2-hydroxy-1-methyl-2H-3,1-benzoxazin-4-one |
| SMILES | CN1c2ccc(F)cc2C(=O)OC1O |
| InChI | InChI=1S/C9H8FNO3/c1-11-7-3-2-5(10)4-6(7)8(12)14-9(11)13/h2-4,9,13H,1H3 |
| InChIKey | DMUUKKVVCGFUEC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |