About 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen
4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen (PubChem CID 144524396) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen.
Analyze 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen?
The IUPAC name of 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen (CID 144524396) is 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen.
What is the SMILES notation for 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen?
The canonical SMILES for 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen is C=Cc1[nH]c(=O)oc1C=C.CC.[H][H].
What is the InChIKey of 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen?
The InChIKey is YPYGANOKYHMXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C2H6.H2/c1-3-5-6(4-2)10-7(9)8-5;1-2;/h3-4H,1-2H2,(H,8,9);1-2H3;1H.
What are the key properties of 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen?
4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen has a molecular weight of 169.22 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane;molecular hydrogen is sourced from PubChem (CID 144524396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).