C11H17NO2 — CID 142057788
4,5-bis[(Z)-prop-1-enyl]-3H-1,3-oxazol-2-one;ethane (PubChem CID 142057788) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 4,5-bis[(Z)-prop-1-enyl]-3H-1,3-oxazol-2-one;ethane.
| Compound Name | 4,5-bis[(Z)-prop-1-enyl]-3H-1,3-oxazol-2-one;ethane |
|---|---|
| PubChem CID | 142057788 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 4,5-bis[(Z)-prop-1-enyl]-3H-1,3-oxazol-2-one;ethane |
| SMILES | C/C=C\c1[nH]c(=O)oc1/C=C\C.CC |
| InChI | InChI=1S/C9H11NO2.C2H6/c1-3-5-7-8(6-4-2)12-9(11)10-7;1-2/h3-6H,1-2H3,(H,10,11);1-2H3/b5-3-,6-4-; |
| InChIKey | KGNIZCMLCJQMTB-VIOUERSGSA-N |
| XLogP | 3.06 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |