C8H9NO2 — CID 123826590
5-buta-1,3-dienyl-4-methyl-3H-1,3-oxazol-2-one (PubChem CID 123826590) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 5-buta-1,3-dienyl-4-methyl-3H-1,3-oxazol-2-one.
| Compound Name | 5-buta-1,3-dienyl-4-methyl-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 123826590 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 5-buta-1,3-dienyl-4-methyl-3H-1,3-oxazol-2-one |
| SMILES | C=CC=Cc1oc(=O)[nH]c1C |
| InChI | InChI=1S/C8H9NO2/c1-3-4-5-7-6(2)9-8(10)11-7/h3-5H,1H2,2H3,(H,9,10) |
| InChIKey | JDIRFAWOFQOOAX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|