C25H44N4O6 — CID 144527929
2-[2-[carboxymethyl-[2-[carboxymethyl-[(5E,7E,9Z)-8-(methylamino)undeca-5,7,9-trien-3-yl]amino]ethyl]amino]ethyl-propylamino]acetic acid (PubChem CID 144527929) has the molecular formula C25H44N4O6 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[2-[carboxymethyl-[2-[carboxymethyl-[(5E,7E,9Z)-8-(methylamino)undeca-5,7,9-trien-3-yl]amino]ethyl]amino]ethyl-propylamino]acetic acid.
| Compound Name | 2-[2-[carboxymethyl-[2-[carboxymethyl-[(5E,7E,9Z)-8-(methylamino)undeca-5,7,9-trien-3-yl]amino]ethyl]amino]ethyl-propylamino]acetic acid |
|---|---|
| PubChem CID | 144527929 |
| Molecular Formula | C25H44N4O6 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | 2-[2-[carboxymethyl-[2-[carboxymethyl-[(5E,7E,9Z)-8-(methylamino)undeca-5,7,9-trien-3-yl]amino]ethyl]amino]ethyl-propylamino]acetic acid |
| SMILES | C/C=C\C(=C/C=C/CC(CC)N(CCN(CCN(CCC)CC(=O)O)CC(=O)O)CC(=O)O)NC |
| InChI | InChI=1S/C25H44N4O6/c1-5-10-21(26-4)11-8-9-12-22(7-3)29(20-25(34)35)17-16-28(19-24(32)33)15-14-27(13-6-2)18-23(30)31/h5,8-11,22,26H,6-7,12-20H2,1-4H3,(H,30,31)(H,32,33)(H,34,35)/b9-8+,10-5-,21-11+ |
| InChIKey | VVJMRJNGTCLPTD-HSTKUHPGSA-N |
| XLogP | 1.96 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|