C13H28N2O2 — CID 144530363
1-N,1-N'-bis(2-methoxyethyl)-1-N,1-N'-dimethylethane-1,1-diamine;prop-1-yne (PubChem CID 144530363) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-N,1-N'-bis(2-methoxyethyl)-1-N,1-N'-dimethylethane-1,1-diamine;prop-1-yne.
| Compound Name | 1-N,1-N'-bis(2-methoxyethyl)-1-N,1-N'-dimethylethane-1,1-diamine;prop-1-yne |
|---|---|
| PubChem CID | 144530363 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-N,1-N'-bis(2-methoxyethyl)-1-N,1-N'-dimethylethane-1,1-diamine;prop-1-yne |
| SMILES | C#CC.COCCN(C)C(C)N(C)CCOC |
| InChI | InChI=1S/C10H24N2O2.C3H4/c1-10(11(2)6-8-13-4)12(3)7-9-14-5;1-3-2/h10H,6-9H2,1-5H3;1H,2H3 |
| InChIKey | JSCZOPGBTQOEKO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|