About 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine
3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine (PubChem CID 79409704) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine.
Analyze 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine?
The IUPAC name of 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine (CID 79409704) is 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine.
What is the SMILES notation for 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine?
The canonical SMILES for 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine is COCCN(C)C(C)C(C)CN.
What is the InChIKey of 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine?
The InChIKey is WDJCFQXFYXVNNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O/c1-8(7-10)9(2)11(3)5-6-12-4/h8-9H,5-7,10H2,1-4H3.
What are the key properties of 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine?
3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine has a molecular weight of 174.29 g/mol, XLogP of 0.55, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2-methoxyethyl)-3-N,2-dimethylbutane-1,3-diamine is sourced from PubChem (CID 79409704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).