C11H16N2O3 — CID 144530706
5-(2-ethylpentylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 144530706) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-(2-ethylpentylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-ethylpentylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 144530706 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 5-(2-ethylpentylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC(C=C1C(=O)NC(=O)NC1=O)CC |
| InChI | InChI=1S/C11H16N2O3/c1-3-5-7(4-2)6-8-9(14)12-11(16)13-10(8)15/h6-7H,3-5H2,1-2H3,(H2,12,13,14,15,16) |
| InChIKey | OREHVODGUWEBDL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|