C14H18N2O6 — CID 18408274
(E)-5-oxo-5-(2,4,6-trioxo-5-pentan-2-yl-1,3-diazinan-5-yl)pent-3-enoic acid (PubChem CID 18408274) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is (E)-5-oxo-5-(2,4,6-trioxo-5-pentan-2-yl-1,3-diazinan-5-yl)pent-3-enoic acid.
| Compound Name | (E)-5-oxo-5-(2,4,6-trioxo-5-pentan-2-yl-1,3-diazinan-5-yl)pent-3-enoic acid |
|---|---|
| PubChem CID | 18408274 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (E)-5-oxo-5-(2,4,6-trioxo-5-pentan-2-yl-1,3-diazinan-5-yl)pent-3-enoic acid |
| SMILES | CCCC(C)C1(C(=O)/C=C/CC(=O)O)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C14H18N2O6/c1-3-5-8(2)14(9(17)6-4-7-10(18)19)11(20)15-13(22)16-12(14)21/h4,6,8H,3,5,7H2,1-2H3,(H,18,19)(H2,15,16,20,21,22)/b6-4+ |
| InChIKey | BNRVJGNTMRVSIU-GQCTYLIASA-N |
| XLogP | 0.38 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|