C18H24N2O4 — CID 134092691
5-pentan-2-yl-5-(1-phenylmethoxyethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 134092691) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-pentan-2-yl-5-(1-phenylmethoxyethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-pentan-2-yl-5-(1-phenylmethoxyethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 134092691 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 5-pentan-2-yl-5-(1-phenylmethoxyethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC(C)C1(C(C)OCc2ccccc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C18H24N2O4/c1-4-8-12(2)18(15(21)19-17(23)20-16(18)22)13(3)24-11-14-9-6-5-7-10-14/h5-7,9-10,12-13H,4,8,11H2,1-3H3,(H2,19,20,21,22,23) |
| InChIKey | UYACIUADOGFNNR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|