C19H22N2O6 — CID 15160043
[2-oxo-3-(2,4,6-trioxo-5-pentan-2-yl-1,3-diazinan-5-yl)propyl] benzoate (PubChem CID 15160043) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is [2-oxo-3-(2,4,6-trioxo-5-pentan-2-yl-1,3-diazinan-5-yl)propyl] benzoate.
| Compound Name | [2-oxo-3-(2,4,6-trioxo-5-pentan-2-yl-1,3-diazinan-5-yl)propyl] benzoate |
|---|---|
| PubChem CID | 15160043 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [2-oxo-3-(2,4,6-trioxo-5-pentan-2-yl-1,3-diazinan-5-yl)propyl] benzoate |
| SMILES | CCCC(C)C1(CC(=O)COC(=O)c2ccccc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C19H22N2O6/c1-3-7-12(2)19(16(24)20-18(26)21-17(19)25)10-14(22)11-27-15(23)13-8-5-4-6-9-13/h4-6,8-9,12H,3,7,10-11H2,1-2H3,(H2,20,21,24,25,26) |
| InChIKey | SXZJRMDSAJZWBY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|