C18H23N2NaO5 — CID 70270925
sodium;benzoic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate (PubChem CID 70270925) has the molecular formula C18H23N2NaO5 and a molecular weight of 370.38 g/mol. Its IUPAC name is sodium;benzoic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate.
| Compound Name | sodium;benzoic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 70270925 |
| Molecular Formula | C18H23N2NaO5 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | sodium;benzoic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
| SMILES | CCCC(C)C1(CC)C(=O)N=C([O-])NC1=O.O=C(O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C11H18N2O3.C7H6O2.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;8-7(9)6-4-2-1-3-5-6;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);1-5H,(H,8,9);/q;;+1/p-1 |
| InChIKey | OUPNBNQSCIJMCU-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|