C15H24N3NaO7 — CID 23696425
sodium;2-(carboxymethylamino)acetic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate (PubChem CID 23696425) has the molecular formula C15H24N3NaO7 and a molecular weight of 381.36 g/mol. Its IUPAC name is sodium;2-(carboxymethylamino)acetic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate.
| Compound Name | sodium;2-(carboxymethylamino)acetic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 23696425 |
| Molecular Formula | C15H24N3NaO7 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | sodium;2-(carboxymethylamino)acetic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
| SMILES | CCCC(C)C1(CC)C(=O)N=C([O-])NC1=O.O=C(O)CNCC(=O)O.[Na+] |
| InChI | InChI=1S/C11H18N2O3.C4H7NO4.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;6-3(7)1-5-2-4(8)9;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);5H,1-2H2,(H,6,7)(H,8,9);/q;;+1/p-1 |
| InChIKey | MEPFMNXAUIISHF-UHFFFAOYSA-M |
| XLogP | -4.06 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|