C17H23N2NaO6S — CID 87676278
sodium;benzenesulfonic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate (PubChem CID 87676278) has the molecular formula C17H23N2NaO6S and a molecular weight of 406.44 g/mol. Its IUPAC name is sodium;benzenesulfonic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate.
| Compound Name | sodium;benzenesulfonic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 87676278 |
| Molecular Formula | C17H23N2NaO6S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | sodium;benzenesulfonic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
| SMILES | CCCC(C)C1(CC)C(=O)N=C([O-])NC1=O.O=S(=O)(O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C11H18N2O3.C6H6O3S.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;7-10(8,9)6-4-2-1-3-5-6;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);1-5H,(H,7,8,9);/q;;+1/p-1 |
| InChIKey | PEBYPJZNVWZNAP-UHFFFAOYSA-M |
| XLogP | -1.87 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|