C19H31N2NaO5 — CID 70524917
sodium;butyl 2-methylprop-2-enoate;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate (PubChem CID 70524917) has the molecular formula C19H31N2NaO5 and a molecular weight of 390.46 g/mol. Its IUPAC name is sodium;butyl 2-methylprop-2-enoate;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate.
| Compound Name | sodium;butyl 2-methylprop-2-enoate;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 70524917 |
| Molecular Formula | C19H31N2NaO5 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | sodium;butyl 2-methylprop-2-enoate;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
| SMILES | C=C(C)C(=O)OCCCC.CCCC(C)C1(CC)C(=O)N=C([O-])NC1=O.[Na+] |
| InChI | InChI=1S/C11H18N2O3.C8H14O2.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;1-4-5-6-10-8(9)7(2)3;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);2,4-6H2,1,3H3;/q;;+1/p-1 |
| InChIKey | CTDBINQWBHTUHD-UHFFFAOYSA-M |
| XLogP | -0.90 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|