C35H60N2NaO3P — CID 90111498
sodium;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate;hexyl-(2,3,4-tributylphenyl)phosphane (PubChem CID 90111498) has the molecular formula C35H60N2NaO3P and a molecular weight of 610.84 g/mol. Its IUPAC name is sodium;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate;hexyl-(2,3,4-tributylphenyl)phosphane.
| Compound Name | sodium;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate;hexyl-(2,3,4-tributylphenyl)phosphane |
|---|---|
| PubChem CID | 90111498 |
| Molecular Formula | C35H60N2NaO3P |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.42 |
| IUPAC Name | sodium;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate;hexyl-(2,3,4-tributylphenyl)phosphane |
| SMILES | CCCC(C)C1(CC)C(=O)N=C([O-])NC1=O.CCCCCCPc1ccc(CCCC)c(CCCC)c1CCCC.[Na+] |
| InChI | InChI=1S/C24H43P.C11H18N2O3.Na/c1-5-9-13-14-20-25-24-19-18-21(15-10-6-2)22(16-11-7-3)23(24)17-12-8-4;1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;/h18-19,25H,5-17,20H2,1-4H3;7H,4-6H2,1-3H3,(H2,12,13,14,15,16);/q;;+1/p-1 |
| InChIKey | YMDPWWPEGFQKKO-UHFFFAOYSA-M |
| XLogP | 4.79 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|