C13H21N2NaO3S — CID 23703939
sodium 5-(3-butylsulfanylpropyl)-5-ethyl-4,6-dioxo-1H-pyrimidin-2-olate (PubChem CID 23703939) has the molecular formula C13H21N2NaO3S and a molecular weight of 308.38 g/mol. Its IUPAC name is sodium 5-(3-butylsulfanylpropyl)-5-ethyl-4,6-dioxo-1H-pyrimidin-2-olate.
| Compound Name | sodium 5-(3-butylsulfanylpropyl)-5-ethyl-4,6-dioxo-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 23703939 |
| Molecular Formula | C13H21N2NaO3S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | sodium 5-(3-butylsulfanylpropyl)-5-ethyl-4,6-dioxo-1H-pyrimidin-2-olate |
| SMILES | CCCCSCCCC1(CC)C(=O)N=C([O-])NC1=O.[Na+] |
| InChI | InChI=1S/C13H22N2O3S.Na/c1-3-5-8-19-9-6-7-13(4-2)10(16)14-12(18)15-11(13)17;/h3-9H2,1-2H3,(H2,14,15,16,17,18);/q;+1/p-1 |
| InChIKey | UYQXTQXXRFNFCH-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|