C11H17N2NaO3S — CID 23703920
sodium 5-butyl-5-(ethylsulfanylmethyl)-4,6-dioxo-1H-pyrimidin-2-olate (PubChem CID 23703920) has the molecular formula C11H17N2NaO3S and a molecular weight of 280.32 g/mol. Its IUPAC name is sodium 5-butyl-5-(ethylsulfanylmethyl)-4,6-dioxo-1H-pyrimidin-2-olate.
| Compound Name | sodium 5-butyl-5-(ethylsulfanylmethyl)-4,6-dioxo-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 23703920 |
| Molecular Formula | C11H17N2NaO3S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | sodium 5-butyl-5-(ethylsulfanylmethyl)-4,6-dioxo-1H-pyrimidin-2-olate |
| SMILES | CCCCC1(CSCC)C(=O)N=C([O-])NC1=O.[Na+] |
| InChI | InChI=1S/C11H18N2O3S.Na/c1-3-5-6-11(7-17-4-2)8(14)12-10(16)13-9(11)15;/h3-7H2,1-2H3,(H2,12,13,14,15,16);/q;+1/p-1 |
| InChIKey | ZPANVODOWVPNHA-UHFFFAOYSA-M |
| XLogP | -2.71 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|