C12H19N2NaO5 — CID 137321503
sodium 5-[2-(2-ethoxyethoxy)ethyl]-5-ethyl-4,6-dioxo-1H-pyrimidin-2-olate (PubChem CID 137321503) has the molecular formula C12H19N2NaO5 and a molecular weight of 294.28 g/mol. Its IUPAC name is sodium 5-[2-(2-ethoxyethoxy)ethyl]-5-ethyl-4,6-dioxo-1H-pyrimidin-2-olate.
| Compound Name | sodium 5-[2-(2-ethoxyethoxy)ethyl]-5-ethyl-4,6-dioxo-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 137321503 |
| Molecular Formula | C12H19N2NaO5 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | sodium 5-[2-(2-ethoxyethoxy)ethyl]-5-ethyl-4,6-dioxo-1H-pyrimidin-2-olate |
| SMILES | CCOCCOCCC1(CC)C(=O)N=C([O-])NC1=O.[Na+] |
| InChI | InChI=1S/C12H20N2O5.Na/c1-3-12(5-6-19-8-7-18-4-2)9(15)13-11(17)14-10(12)16;/h3-8H2,1-2H3,(H2,13,14,15,16,17);/q;+1/p-1 |
| InChIKey | YJQDODGWIOYBGU-UHFFFAOYSA-M |
| XLogP | -3.80 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|