C15H25N2NaO5 — CID 67913359
sodium;ethyl acetate;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate (PubChem CID 67913359) has the molecular formula C15H25N2NaO5 and a molecular weight of 336.36 g/mol. Its IUPAC name is sodium;ethyl acetate;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate.
| Compound Name | sodium;ethyl acetate;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 67913359 |
| Molecular Formula | C15H25N2NaO5 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | sodium;ethyl acetate;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
| SMILES | CCCC(C)C1(CC)C(=O)N=C([O-])NC1=O.CCOC(C)=O.[Na+] |
| InChI | InChI=1S/C11H18N2O3.C4H8O2.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;1-3-6-4(2)5;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);3H2,1-2H3;/q;;+1/p-1 |
| InChIKey | HHQZHOFBZRRWAD-UHFFFAOYSA-M |
| XLogP | -2.23 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|