C15H23N2NaO5 — CID 67062371
sodium;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate;2-methylprop-2-enoic acid (PubChem CID 67062371) has the molecular formula C15H23N2NaO5 and a molecular weight of 334.35 g/mol. Its IUPAC name is sodium;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate;2-methylprop-2-enoic acid.
| Compound Name | sodium;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67062371 |
| Molecular Formula | C15H23N2NaO5 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | sodium;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCCC(C)C1(CC)C(=O)N=C([O-])NC1=O.[Na+] |
| InChI | InChI=1S/C11H18N2O3.C4H6O2.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;1-3(2)4(5)6;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);1H2,2H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | RIDGLOZGICTMOB-UHFFFAOYSA-M |
| XLogP | -2.16 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|