C20H27N4NaO7 — CID 135351865
sodium;2,2-bis(2-cyanoethyl)propanedioic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate (PubChem CID 135351865) has the molecular formula C20H27N4NaO7 and a molecular weight of 458.45 g/mol. Its IUPAC name is sodium;2,2-bis(2-cyanoethyl)propanedioic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate.
| Compound Name | sodium;2,2-bis(2-cyanoethyl)propanedioic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 135351865 |
| Molecular Formula | C20H27N4NaO7 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | sodium;2,2-bis(2-cyanoethyl)propanedioic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
| SMILES | CCCC(C)C1(CC)C(=O)N=C([O-])NC1=O.N#CCCC(CCC#N)(C(=O)O)C(=O)O.[Na+] |
| InChI | InChI=1S/C11H18N2O3.C9H10N2O4.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;10-5-1-3-9(7(12)13,8(14)15)4-2-6-11;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);1-4H2,(H,12,13)(H,14,15);/q;;+1/p-1 |
| InChIKey | MCFZENGWMOPTLJ-UHFFFAOYSA-M |
| XLogP | -2.05 |
| TPSA | 203.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|