C18H24N3NaO5 — CID 67128297
sodium;4-aminobenzoic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate (PubChem CID 67128297) has the molecular formula C18H24N3NaO5 and a molecular weight of 385.40 g/mol. Its IUPAC name is sodium;4-aminobenzoic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate.
| Compound Name | sodium;4-aminobenzoic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 67128297 |
| Molecular Formula | C18H24N3NaO5 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | sodium;4-aminobenzoic acid;5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidin-2-olate |
| SMILES | CCCC(C)C1(CC)C(=O)N=C([O-])NC1=O.Nc1ccc(C(=O)O)cc1.[Na+] |
| InChI | InChI=1S/C11H18N2O3.C7H7NO2.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;8-6-3-1-5(2-4-6)7(9)10;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);1-4H,8H2,(H,9,10);/q;;+1/p-1 |
| InChIKey | KUQSYXUSUPOMPI-UHFFFAOYSA-M |
| XLogP | -1.84 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|