C7H9N3O6 — CID 118541146
3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propanoic acid (PubChem CID 118541146) has the molecular formula C7H9N3O6 and a molecular weight of 231.16 g/mol. Its IUPAC name is 3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propanoic acid.
| Compound Name | 3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propanoic acid |
|---|---|
| PubChem CID | 118541146 |
| Molecular Formula | C7H9N3O6 |
| Molecular Weight | 231.16 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propanoic acid |
| SMILES | O=C(O)CCC1(NO)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C7H9N3O6/c11-3(12)1-2-7(10-16)4(13)8-6(15)9-5(7)14/h10,16H,1-2H2,(H,11,12)(H2,8,9,13,14,15) |
| InChIKey | VFBAQDWUNZJRCM-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.16 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|