C20H23NO — CID 144530743
(2R,6R)-4-methyl-9-propyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene (PubChem CID 144530743) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (2R,6R)-4-methyl-9-propyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene.
| Compound Name | (2R,6R)-4-methyl-9-propyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene |
|---|---|
| PubChem CID | 144530743 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (2R,6R)-4-methyl-9-propyl-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaene |
| SMILES | CCCc1ccc2c(c1)[C@@H]1CN(C)C[C@H]1c1ccccc1O2 |
| InChI | InChI=1S/C20H23NO/c1-3-6-14-9-10-20-16(11-14)18-13-21(2)12-17(18)15-7-4-5-8-19(15)22-20/h4-5,7-11,17-18H,3,6,12-13H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | VPKNNBWUAXFACX-ROUUACIJSA-N |
| XLogP | 4.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |