C19H38O — CID 144530855
2,6,9,10,10-pentamethyl-9-propan-2-ylundec-1-en-3-ol (PubChem CID 144530855) has the molecular formula C19H38O and a molecular weight of 282.51 g/mol. Its IUPAC name is 2,6,9,10,10-pentamethyl-9-propan-2-ylundec-1-en-3-ol.
| Compound Name | 2,6,9,10,10-pentamethyl-9-propan-2-ylundec-1-en-3-ol |
|---|---|
| PubChem CID | 144530855 |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 282.29 |
| IUPAC Name | 2,6,9,10,10-pentamethyl-9-propan-2-ylundec-1-en-3-ol |
| SMILES | C=C(C)C(O)CCC(C)CCC(C)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H38O/c1-14(2)17(20)11-10-16(5)12-13-19(9,15(3)4)18(6,7)8/h15-17,20H,1,10-13H2,2-9H3 |
| InChIKey | DBIYFHWTYSKJDY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|