C11H21BrO3 — CID 88752071
1-bromo-1-methoxy-8-methylnon-8-ene-1,7-diol (PubChem CID 88752071) has the molecular formula C11H21BrO3 and a molecular weight of 281.19 g/mol. Its IUPAC name is 1-bromo-1-methoxy-8-methylnon-8-ene-1,7-diol.
| Compound Name | 1-bromo-1-methoxy-8-methylnon-8-ene-1,7-diol |
|---|---|
| PubChem CID | 88752071 |
| Molecular Formula | C11H21BrO3 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-bromo-1-methoxy-8-methylnon-8-ene-1,7-diol |
| SMILES | C=C(C)C(O)CCCCCC(O)(Br)OC |
| InChI | InChI=1S/C11H21BrO3/c1-9(2)10(13)7-5-4-6-8-11(12,14)15-3/h10,13-14H,1,4-8H2,2-3H3 |
| InChIKey | VWTSELCQJUXCOM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|