C34H70O12 — CID 91471952
7,8,9-tris(6,6-dihydroxyhexyl)-8-methylpentadecane-1,1,7,9,15,15-hexol (PubChem CID 91471952) has the molecular formula C34H70O12 and a molecular weight of 670.92 g/mol. Its IUPAC name is 7,8,9-tris(6,6-dihydroxyhexyl)-8-methylpentadecane-1,1,7,9,15,15-hexol.
| Compound Name | 7,8,9-tris(6,6-dihydroxyhexyl)-8-methylpentadecane-1,1,7,9,15,15-hexol |
|---|---|
| PubChem CID | 91471952 |
| Molecular Formula | C34H70O12 |
| Molecular Weight | 670.92 g/mol |
| Exact Mass | 670.49 |
| IUPAC Name | 7,8,9-tris(6,6-dihydroxyhexyl)-8-methylpentadecane-1,1,7,9,15,15-hexol |
| SMILES | CC(CCCCCC(O)O)(C(O)(CCCCCC(O)O)CCCCCC(O)O)C(O)(CCCCCC(O)O)CCCCCC(O)O |
| InChI | InChI=1S/C34H70O12/c1-32(22-12-2-7-17-27(35)36,33(45,23-13-3-8-18-28(37)38)24-14-4-9-19-29(39)40)34(46,25-15-5-10-20-30(41)42)26-16-6-11-21-31(43)44/h27-31,35-46H,2-26H2,1H3 |
| InChIKey | PTUZVTGHLHWELB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 242.76 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.92 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|