C24H27IN2O5 — CID 144532332
iodo (3aS,4R,5R,6S,7aS)-2-(dimethylamino)-4,5-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylate (PubChem CID 144532332) has the molecular formula C24H27IN2O5 and a molecular weight of 550.39 g/mol. Its IUPAC name is iodo (3aS,4R,5R,6S,7aS)-2-(dimethylamino)-4,5-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylate.
| Compound Name | iodo (3aS,4R,5R,6S,7aS)-2-(dimethylamino)-4,5-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 144532332 |
| Molecular Formula | C24H27IN2O5 |
| Molecular Weight | 550.39 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | iodo (3aS,4R,5R,6S,7aS)-2-(dimethylamino)-4,5-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-6-carboxylate |
| SMILES | CN(C)C1=N[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C(C(=O)OI)C[C@@H]2O1 |
| InChI | InChI=1S/C24H27IN2O5/c1-27(2)24-26-20-19(31-24)13-18(23(28)32-25)21(29-14-16-9-5-3-6-10-16)22(20)30-15-17-11-7-4-8-12-17/h3-12,18-22H,13-15H2,1-2H3/t18?,19-,20-,21+,22+/m0/s1 |
| InChIKey | AAZCBVOKIRUCQD-UPGLXXFKSA-N |
| XLogP | 3.76 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|