C24H29FN2O3 — CID 71152529
(3aS,4R,5R,6S,7aS)-N-ethyl-6-(fluoromethyl)-4,5-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine (PubChem CID 71152529) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is (3aS,4R,5R,6S,7aS)-N-ethyl-6-(fluoromethyl)-4,5-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine.
| Compound Name | (3aS,4R,5R,6S,7aS)-N-ethyl-6-(fluoromethyl)-4,5-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 71152529 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (3aS,4R,5R,6S,7aS)-N-ethyl-6-(fluoromethyl)-4,5-bis(phenylmethoxy)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine |
| SMILES | CCNC1=N[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C(CF)C[C@@H]2O1 |
| InChI | InChI=1S/C24H29FN2O3/c1-2-26-24-27-21-20(30-24)13-19(14-25)22(28-15-17-9-5-3-6-10-17)23(21)29-16-18-11-7-4-8-12-18/h3-12,19-23H,2,13-16H2,1H3,(H,26,27)/t19?,20-,21-,22+,23+/m0/s1 |
| InChIKey | TWRHDQQRGJBZCQ-BJHAUBCZSA-N |
| XLogP | 3.88 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |