C7H17N4+ — CID 144534926
[(Z)-1,2-diamino-3-(ethylamino)but-2-enylidene]-methylazanium (PubChem CID 144534926) has the molecular formula C7H17N4+ and a molecular weight of 157.24 g/mol. Its IUPAC name is [(Z)-1,2-diamino-3-(ethylamino)but-2-enylidene]-methylazanium.
| Compound Name | [(Z)-1,2-diamino-3-(ethylamino)but-2-enylidene]-methylazanium |
|---|---|
| PubChem CID | 144534926 |
| Molecular Formula | C7H17N4+ |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.14 |
| IUPAC Name | [(Z)-1,2-diamino-3-(ethylamino)but-2-enylidene]-methylazanium |
| SMILES | CCN/C(C)=C(N)/C(N)=[NH+]/C |
| InChI | InChI=1S/C7H16N4/c1-4-11-5(2)6(8)7(9)10-3/h11H,4,8H2,1-3H3,(H2,9,10)/p+1/b6-5- |
| InChIKey | RLYLYPAQFPGFGM-WAYWQWQTSA-O |
| XLogP | -2.15 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|