C16H18FN3OS — CID 144537851
6-fluoro-3-(8-formyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazin-3-yl)-2-methylbenzonitrile (PubChem CID 144537851) has the molecular formula C16H18FN3OS and a molecular weight of 319.41 g/mol. Its IUPAC name is 6-fluoro-3-(8-formyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazin-3-yl)-2-methylbenzonitrile.
| Compound Name | 6-fluoro-3-(8-formyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazin-3-yl)-2-methylbenzonitrile |
|---|---|
| PubChem CID | 144537851 |
| Molecular Formula | C16H18FN3OS |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-fluoro-3-(8-formyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]thiazin-3-yl)-2-methylbenzonitrile |
| SMILES | Cc1c(C2CN3CCN(C=O)CC3CS2)ccc(F)c1C#N |
| InChI | InChI=1S/C16H18FN3OS/c1-11-13(2-3-15(17)14(11)6-18)16-8-20-5-4-19(10-21)7-12(20)9-22-16/h2-3,10,12,16H,4-5,7-9H2,1H3 |
| InChIKey | GDTRZDHHNWQIKZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|