C11H17N3 — CID 144540135
ethane;5-ethenyl-1-[(1Z)-3-methylbuta-1,3-dienyl]-1,2,4-triazole (PubChem CID 144540135) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is ethane;5-ethenyl-1-[(1Z)-3-methylbuta-1,3-dienyl]-1,2,4-triazole.
| Compound Name | ethane;5-ethenyl-1-[(1Z)-3-methylbuta-1,3-dienyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 144540135 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | ethane;5-ethenyl-1-[(1Z)-3-methylbuta-1,3-dienyl]-1,2,4-triazole |
| SMILES | C=Cc1ncnn1/C=C\C(=C)C.CC |
| InChI | InChI=1S/C9H11N3.C2H6/c1-4-9-10-7-11-12(9)6-5-8(2)3;1-2/h4-7H,1-2H2,3H3;1-2H3/b6-5-; |
| InChIKey | DLGRKMWSCDQYPR-YSMBQZINSA-N |
| XLogP | 2.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|